C36H30Cl2N2O5S — CID 88866820
2-[[4-[3-[4-(2,4-dichlorophenyl)anilino]-3-oxo-2-(4-phenylphenyl)propyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88866820) has the molecular formula C36H30Cl2N2O5S and a molecular weight of 673.62 g/mol. Its IUPAC name is 2-[[4-[3-[4-(2,4-dichlorophenyl)anilino]-3-oxo-2-(4-phenylphenyl)propyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[3-[4-(2,4-dichlorophenyl)anilino]-3-oxo-2-(4-phenylphenyl)propyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88866820 |
| Molecular Formula | C36H30Cl2N2O5S |
| Molecular Weight | 673.62 g/mol |
| Exact Mass | 672.13 |
| IUPAC Name | 2-[[4-[3-[4-(2,4-dichlorophenyl)anilino]-3-oxo-2-(4-phenylphenyl)propyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | O=C(NCCS(=O)(=O)O)c1ccc(CC(C(=O)Nc2ccc(-c3ccc(Cl)cc3Cl)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C36H30Cl2N2O5S/c37-30-16-19-32(34(38)23-30)27-14-17-31(18-15-27)40-36(42)33(28-12-10-26(11-13-28)25-4-2-1-3-5-25)22-24-6-8-29(9-7-24)35(41)39-20-21-46(43,44)45/h1-19,23,33H,20-22H2,(H,39,41)(H,40,42)(H,43,44,45) |
| InChIKey | JIUKCLUHRGEQNX-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.62 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|