C29H30Cl2N2O5S — CID 88866954
2-[[4-[2-[[4-(2,4-dichlorophenyl)phenyl]carbamoyl]-5-methylhex-4-enyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88866954) has the molecular formula C29H30Cl2N2O5S and a molecular weight of 589.54 g/mol. Its IUPAC name is 2-[[4-[2-[[4-(2,4-dichlorophenyl)phenyl]carbamoyl]-5-methylhex-4-enyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2-[[4-(2,4-dichlorophenyl)phenyl]carbamoyl]-5-methylhex-4-enyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88866954 |
| Molecular Formula | C29H30Cl2N2O5S |
| Molecular Weight | 589.54 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | 2-[[4-[2-[[4-(2,4-dichlorophenyl)phenyl]carbamoyl]-5-methylhex-4-enyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CC(C)=CCC(Cc1ccc(C(=O)NCCS(=O)(=O)O)cc1)C(=O)Nc1ccc(-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C29H30Cl2N2O5S/c1-19(2)3-6-23(17-20-4-7-22(8-5-20)28(34)32-15-16-39(36,37)38)29(35)33-25-12-9-21(10-13-25)26-14-11-24(30)18-27(26)31/h3-5,7-14,18,23H,6,15-17H2,1-2H3,(H,32,34)(H,33,35)(H,36,37,38) |
| InChIKey | VOHFTLMOIMBZHB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.54 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|