C28H40N2O5S — CID 88866767
2-[[4-[2-[(4-tert-butylphenyl)carbamoyl]octyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88866767) has the molecular formula C28H40N2O5S and a molecular weight of 516.70 g/mol. Its IUPAC name is 2-[[4-[2-[(4-tert-butylphenyl)carbamoyl]octyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2-[(4-tert-butylphenyl)carbamoyl]octyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88866767 |
| Molecular Formula | C28H40N2O5S |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 2-[[4-[2-[(4-tert-butylphenyl)carbamoyl]octyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CCCCCCC(Cc1ccc(C(=O)NCCS(=O)(=O)O)cc1)C(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H40N2O5S/c1-5-6-7-8-9-23(27(32)30-25-16-14-24(15-17-25)28(2,3)4)20-21-10-12-22(13-11-21)26(31)29-18-19-36(33,34)35/h10-17,23H,5-9,18-20H2,1-4H3,(H,29,31)(H,30,32)(H,33,34,35) |
| InChIKey | HPEQJRHBKAHYBG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|