C41H39Cl3N2O5S — CID 88867300
2-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[3-methyl-4-(2,3,4-trichlorophenyl)anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88867300) has the molecular formula C41H39Cl3N2O5S and a molecular weight of 778.20 g/mol. Its IUPAC name is 2-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[3-methyl-4-(2,3,4-trichlorophenyl)anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[3-methyl-4-(2,3,4-trichlorophenyl)anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88867300 |
| Molecular Formula | C41H39Cl3N2O5S |
| Molecular Weight | 778.20 g/mol |
| Exact Mass | 776.16 |
| IUPAC Name | 2-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[3-methyl-4-(2,3,4-trichlorophenyl)anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | Cc1cc(NC(=O)C(Cc2ccc(C(=O)NCCS(=O)(=O)O)cc2)c2ccc(-c3ccc(C(C)(C)C)cc3)cc2)ccc1-c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C41H39Cl3N2O5S/c1-25-23-32(17-18-33(25)34-19-20-36(42)38(44)37(34)43)46-40(48)35(24-26-5-7-30(8-6-26)39(47)45-21-22-52(49,50)51)29-11-9-27(10-12-29)28-13-15-31(16-14-28)41(2,3)4/h5-20,23,35H,21-22,24H2,1-4H3,(H,45,47)(H,46,48)(H,49,50,51) |
| InChIKey | VJFNTUQTTPUWDL-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.20 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|