C34H36N2O5S — CID 139427313
2-[[4-[(2R)-3-anilino-2-[4-(4-tert-butylphenyl)phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 139427313) has the molecular formula C34H36N2O5S and a molecular weight of 584.74 g/mol. Its IUPAC name is 2-[[4-[(2R)-3-anilino-2-[4-(4-tert-butylphenyl)phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[(2R)-3-anilino-2-[4-(4-tert-butylphenyl)phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 139427313 |
| Molecular Formula | C34H36N2O5S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | 2-[[4-[(2R)-3-anilino-2-[4-(4-tert-butylphenyl)phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CC(C)(C)c1ccc(-c2ccc([C@@H](Cc3ccc(C(=O)NCCS(=O)(=O)O)cc3)C(=O)Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C34H36N2O5S/c1-34(2,3)29-19-17-26(18-20-29)25-13-15-27(16-14-25)31(33(38)36-30-7-5-4-6-8-30)23-24-9-11-28(12-10-24)32(37)35-21-22-42(39,40)41/h4-20,31H,21-23H2,1-3H3,(H,35,37)(H,36,38)(H,39,40,41)/t31-/m1/s1 |
| InChIKey | WOBDLKRYMQZUDO-WJOKGBTCSA-N |
| XLogP | 6.23 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|