C35H34N2O6S — CID 88866810
[[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-(4-tert-butylphenyl)-3-oxopropyl]benzoyl]amino]methanesulfonic acid (PubChem CID 88866810) has the molecular formula C35H34N2O6S and a molecular weight of 610.73 g/mol. Its IUPAC name is [[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-(4-tert-butylphenyl)-3-oxopropyl]benzoyl]amino]methanesulfonic acid.
| Compound Name | [[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-(4-tert-butylphenyl)-3-oxopropyl]benzoyl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 88866810 |
| Molecular Formula | C35H34N2O6S |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | [[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-(4-tert-butylphenyl)-3-oxopropyl]benzoyl]amino]methanesulfonic acid |
| SMILES | CC(C)(C)c1ccc(C(Cc2ccc(C(=O)NCS(=O)(=O)O)cc2)C(=O)Nc2ccc(-c3cc4ccccc4o3)cc2)cc1 |
| InChI | InChI=1S/C35H34N2O6S/c1-35(2,3)28-16-12-24(13-17-28)30(20-23-8-10-26(11-9-23)33(38)36-22-44(40,41)42)34(39)37-29-18-14-25(15-19-29)32-21-27-6-4-5-7-31(27)43-32/h4-19,21,30H,20,22H2,1-3H3,(H,36,38)(H,37,39)(H,40,41,42) |
| InChIKey | ZPWXJFWIEPABEE-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|