C37H31NO6S2 — CID 147580532
4-[4-[3-[4-(1-benzofuran-2-yl)anilino]-3-oxo-2-(4-thiophen-2-ylphenyl)propyl]phenyl]-4-oxobutane-1-sulfonic acid (PubChem CID 147580532) has the molecular formula C37H31NO6S2 and a molecular weight of 649.79 g/mol. Its IUPAC name is 4-[4-[3-[4-(1-benzofuran-2-yl)anilino]-3-oxo-2-(4-thiophen-2-ylphenyl)propyl]phenyl]-4-oxobutane-1-sulfonic acid.
| Compound Name | 4-[4-[3-[4-(1-benzofuran-2-yl)anilino]-3-oxo-2-(4-thiophen-2-ylphenyl)propyl]phenyl]-4-oxobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 147580532 |
| Molecular Formula | C37H31NO6S2 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.16 |
| IUPAC Name | 4-[4-[3-[4-(1-benzofuran-2-yl)anilino]-3-oxo-2-(4-thiophen-2-ylphenyl)propyl]phenyl]-4-oxobutane-1-sulfonic acid |
| SMILES | O=C(CCCS(=O)(=O)O)c1ccc(CC(C(=O)Nc2ccc(-c3cc4ccccc4o3)cc2)c2ccc(-c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C37H31NO6S2/c39-33(6-4-22-46(41,42)43)27-11-9-25(10-12-27)23-32(26-13-15-29(16-14-26)36-8-3-21-45-36)37(40)38-31-19-17-28(18-20-31)35-24-30-5-1-2-7-34(30)44-35/h1-3,5,7-21,24,32H,4,6,22-23H2,(H,38,40)(H,41,42,43) |
| InChIKey | FWIFWHPHRFKCAR-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|