C32H29ClN2O5S — CID 163584268
2-[[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-(4-chlorophenyl)propyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 163584268) has the molecular formula C32H29ClN2O5S and a molecular weight of 589.11 g/mol. Its IUPAC name is 2-[[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-(4-chlorophenyl)propyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-(4-chlorophenyl)propyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 163584268 |
| Molecular Formula | C32H29ClN2O5S |
| Molecular Weight | 589.11 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | 2-[[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-(4-chlorophenyl)propyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | O=C(NCCS(=O)(=O)O)c1ccc(CC(CNc2ccc(-c3cc4ccccc4o3)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C32H29ClN2O5S/c33-28-13-9-23(10-14-28)27(19-22-5-7-25(8-6-22)32(36)34-17-18-41(37,38)39)21-35-29-15-11-24(12-16-29)31-20-26-3-1-2-4-30(26)40-31/h1-16,20,27,35H,17-19,21H2,(H,34,36)(H,37,38,39) |
| InChIKey | GKDWRNMCNAIWTB-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.11 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|