C28H29FN2O6S — CID 146224608
2-[[4-[[1-[4-(1-benzofuran-2-yl)-3-fluorophenoxy]-3-methylbutan-2-yl]amino]benzoyl]amino]ethanesulfonic acid (PubChem CID 146224608) has the molecular formula C28H29FN2O6S and a molecular weight of 540.61 g/mol. Its IUPAC name is 2-[[4-[[1-[4-(1-benzofuran-2-yl)-3-fluorophenoxy]-3-methylbutan-2-yl]amino]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[[1-[4-(1-benzofuran-2-yl)-3-fluorophenoxy]-3-methylbutan-2-yl]amino]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 146224608 |
| Molecular Formula | C28H29FN2O6S |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 2-[[4-[[1-[4-(1-benzofuran-2-yl)-3-fluorophenoxy]-3-methylbutan-2-yl]amino]benzoyl]amino]ethanesulfonic acid |
| SMILES | CC(C)C(COc1ccc(-c2cc3ccccc3o2)c(F)c1)Nc1ccc(C(=O)NCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C28H29FN2O6S/c1-18(2)25(31-21-9-7-19(8-10-21)28(32)30-13-14-38(33,34)35)17-36-22-11-12-23(24(29)16-22)27-15-20-5-3-4-6-26(20)37-27/h3-12,15-16,18,25,31H,13-14,17H2,1-2H3,(H,30,32)(H,33,34,35) |
| InChIKey | MWYPVUJNCVHZLP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|