C37H38N2O7S — CID 88867447
2-[[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-(4-tert-butylphenyl)-3-oxopropyl]-3-methoxybenzoyl]amino]ethanesulfonic acid (PubChem CID 88867447) has the molecular formula C37H38N2O7S and a molecular weight of 654.79 g/mol. Its IUPAC name is 2-[[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-(4-tert-butylphenyl)-3-oxopropyl]-3-methoxybenzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-(4-tert-butylphenyl)-3-oxopropyl]-3-methoxybenzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88867447 |
| Molecular Formula | C37H38N2O7S |
| Molecular Weight | 654.79 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | 2-[[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-(4-tert-butylphenyl)-3-oxopropyl]-3-methoxybenzoyl]amino]ethanesulfonic acid |
| SMILES | COc1cc(C(=O)NCCS(=O)(=O)O)ccc1CC(C(=O)Nc1ccc(-c2cc3ccccc3o2)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C37H38N2O7S/c1-37(2,3)29-15-11-24(12-16-29)31(21-27-9-10-28(23-33(27)45-4)35(40)38-19-20-47(42,43)44)36(41)39-30-17-13-25(14-18-30)34-22-26-7-5-6-8-32(26)46-34/h5-18,22-23,31H,19-21H2,1-4H3,(H,38,40)(H,39,41)(H,42,43,44) |
| InChIKey | MDLMIMRAYWIMLK-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.79 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|