C42H44N2O5S — CID 88867505
2-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[4-(2,4-dimethylphenyl)anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88867505) has the molecular formula C42H44N2O5S and a molecular weight of 688.89 g/mol. Its IUPAC name is 2-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[4-(2,4-dimethylphenyl)anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[4-(2,4-dimethylphenyl)anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88867505 |
| Molecular Formula | C42H44N2O5S |
| Molecular Weight | 688.89 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | 2-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[4-(2,4-dimethylphenyl)anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | Cc1ccc(-c2ccc(NC(=O)C(Cc3ccc(C(=O)NCCS(=O)(=O)O)cc3)c3ccc(-c4ccc(C(C)(C)C)cc4)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C42H44N2O5S/c1-28-6-23-38(29(2)26-28)33-17-21-37(22-18-33)44-41(46)39(27-30-7-9-35(10-8-30)40(45)43-24-25-50(47,48)49)34-13-11-31(12-14-34)32-15-19-36(20-16-32)42(3,4)5/h6-23,26,39H,24-25,27H2,1-5H3,(H,43,45)(H,44,46)(H,47,48,49) |
| InChIKey | SYICARWDNXSPKE-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.89 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|