C40H40N2O5S — CID 88867364
2-[[4-[3-[4-(2,4-dimethylphenyl)anilino]-2-[4-(2,4-dimethylphenyl)phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88867364) has the molecular formula C40H40N2O5S and a molecular weight of 660.84 g/mol. Its IUPAC name is 2-[[4-[3-[4-(2,4-dimethylphenyl)anilino]-2-[4-(2,4-dimethylphenyl)phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[3-[4-(2,4-dimethylphenyl)anilino]-2-[4-(2,4-dimethylphenyl)phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88867364 |
| Molecular Formula | C40H40N2O5S |
| Molecular Weight | 660.84 g/mol |
| Exact Mass | 660.27 |
| IUPAC Name | 2-[[4-[3-[4-(2,4-dimethylphenyl)anilino]-2-[4-(2,4-dimethylphenyl)phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | Cc1ccc(-c2ccc(NC(=O)C(Cc3ccc(C(=O)NCCS(=O)(=O)O)cc3)c3ccc(-c4ccc(C)cc4C)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C40H40N2O5S/c1-26-5-19-36(28(3)23-26)31-11-13-33(14-12-31)38(25-30-7-9-34(10-8-30)39(43)41-21-22-48(45,46)47)40(44)42-35-17-15-32(16-18-35)37-20-6-27(2)24-29(37)4/h5-20,23-24,38H,21-22,25H2,1-4H3,(H,41,43)(H,42,44)(H,45,46,47) |
| InChIKey | MTGBGUIDTWNRIF-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.84 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|