C44H50N2O5S — CID 131990135
2-[[4-[(2R)-2-[4-[(2E,4E)-5-tert-butylhepta-2,4,6-trien-2-yl]phenyl]-3-oxo-3-[4-(2,4,6-trimethylphenyl)anilino]propyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 131990135) has the molecular formula C44H50N2O5S and a molecular weight of 718.96 g/mol. Its IUPAC name is 2-[[4-[(2R)-2-[4-[(2E,4E)-5-tert-butylhepta-2,4,6-trien-2-yl]phenyl]-3-oxo-3-[4-(2,4,6-trimethylphenyl)anilino]propyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[(2R)-2-[4-[(2E,4E)-5-tert-butylhepta-2,4,6-trien-2-yl]phenyl]-3-oxo-3-[4-(2,4,6-trimethylphenyl)anilino]propyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 131990135 |
| Molecular Formula | C44H50N2O5S |
| Molecular Weight | 718.96 g/mol |
| Exact Mass | 718.34 |
| IUPAC Name | 2-[[4-[(2R)-2-[4-[(2E,4E)-5-tert-butylhepta-2,4,6-trien-2-yl]phenyl]-3-oxo-3-[4-(2,4,6-trimethylphenyl)anilino]propyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | C=C/C(=C\C=C(/C)c1ccc([C@@H](Cc2ccc(C(=O)NCCS(=O)(=O)O)cc2)C(=O)Nc2ccc(-c3c(C)cc(C)cc3C)cc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C44H50N2O5S/c1-9-38(44(6,7)8)21-10-30(3)34-15-17-35(18-16-34)40(28-33-11-13-37(14-12-33)42(47)45-24-25-52(49,50)51)43(48)46-39-22-19-36(20-23-39)41-31(4)26-29(2)27-32(41)5/h9-23,26-27,40H,1,24-25,28H2,2-8H3,(H,45,47)(H,46,48)(H,49,50,51)/b30-10+,38-21+/t40-/m1/s1 |
| InChIKey | GPXRMCYZLRGGON-JMWQSLQGSA-N |
| XLogP | 9.42 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.96 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|