C37H43N3O5S — CID 146224093
2-[[4-[[1-(4-tert-butylanilino)-1-oxo-3-[4-(2,4,6-trimethylphenyl)phenyl]propan-2-yl]amino]benzoyl]amino]ethanesulfonic acid (PubChem CID 146224093) has the molecular formula C37H43N3O5S and a molecular weight of 641.83 g/mol. Its IUPAC name is 2-[[4-[[1-(4-tert-butylanilino)-1-oxo-3-[4-(2,4,6-trimethylphenyl)phenyl]propan-2-yl]amino]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[[1-(4-tert-butylanilino)-1-oxo-3-[4-(2,4,6-trimethylphenyl)phenyl]propan-2-yl]amino]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 146224093 |
| Molecular Formula | C37H43N3O5S |
| Molecular Weight | 641.83 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | 2-[[4-[[1-(4-tert-butylanilino)-1-oxo-3-[4-(2,4,6-trimethylphenyl)phenyl]propan-2-yl]amino]benzoyl]amino]ethanesulfonic acid |
| SMILES | Cc1cc(C)c(-c2ccc(CC(Nc3ccc(C(=O)NCCS(=O)(=O)O)cc3)C(=O)Nc3ccc(C(C)(C)C)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C37H43N3O5S/c1-24-21-25(2)34(26(3)22-24)28-9-7-27(8-10-28)23-33(36(42)40-32-17-13-30(14-18-32)37(4,5)6)39-31-15-11-29(12-16-31)35(41)38-19-20-46(43,44)45/h7-18,21-22,33,39H,19-20,23H2,1-6H3,(H,38,41)(H,40,42)(H,43,44,45) |
| InChIKey | WMMHPQUFMBLMID-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.83 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|