C41H40Cl2N2O5S — CID 88867445
2-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[4-(2,4-dichlorophenyl)-3-methylanilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88867445) has the molecular formula C41H40Cl2N2O5S and a molecular weight of 743.75 g/mol. Its IUPAC name is 2-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[4-(2,4-dichlorophenyl)-3-methylanilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[4-(2,4-dichlorophenyl)-3-methylanilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88867445 |
| Molecular Formula | C41H40Cl2N2O5S |
| Molecular Weight | 743.75 g/mol |
| Exact Mass | 742.20 |
| IUPAC Name | 2-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[4-(2,4-dichlorophenyl)-3-methylanilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | Cc1cc(NC(=O)C(Cc2ccc(C(=O)NCCS(=O)(=O)O)cc2)c2ccc(-c3ccc(C(C)(C)C)cc3)cc2)ccc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C41H40Cl2N2O5S/c1-26-23-34(18-20-35(26)36-19-17-33(42)25-38(36)43)45-40(47)37(24-27-5-7-31(8-6-27)39(46)44-21-22-51(48,49)50)30-11-9-28(10-12-30)29-13-15-32(16-14-29)41(2,3)4/h5-20,23,25,37H,21-22,24H2,1-4H3,(H,44,46)(H,45,47)(H,48,49,50) |
| InChIKey | PONYSVKYZKIKCA-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.75 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|