C28H30Cl2N2O5S — CID 87420523
2-[[4-[2-(4-tert-butylphenyl)-3-(3,4-dichloroanilino)-3-oxopropyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 87420523) has the molecular formula C28H30Cl2N2O5S and a molecular weight of 577.53 g/mol. Its IUPAC name is 2-[[4-[2-(4-tert-butylphenyl)-3-(3,4-dichloroanilino)-3-oxopropyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2-(4-tert-butylphenyl)-3-(3,4-dichloroanilino)-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 87420523 |
| Molecular Formula | C28H30Cl2N2O5S |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | 2-[[4-[2-(4-tert-butylphenyl)-3-(3,4-dichloroanilino)-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CC(C)(C)c1ccc(C(Cc2ccc(C(=O)NCCS(=O)(=O)O)cc2)C(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C28H30Cl2N2O5S/c1-28(2,3)21-10-8-19(9-11-21)23(27(34)32-22-12-13-24(29)25(30)17-22)16-18-4-6-20(7-5-18)26(33)31-14-15-38(35,36)37/h4-13,17,23H,14-16H2,1-3H3,(H,31,33)(H,32,34)(H,35,36,37) |
| InChIKey | CUFFWGFUSMSDFP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|