C30H32F2N2O5S — CID 88866942
2-[[4-[3-(3,4-difluoroanilino)-2-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88866942) has the molecular formula C30H32F2N2O5S and a molecular weight of 570.66 g/mol. Its IUPAC name is 2-[[4-[3-(3,4-difluoroanilino)-2-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[3-(3,4-difluoroanilino)-2-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88866942 |
| Molecular Formula | C30H32F2N2O5S |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 2-[[4-[3-(3,4-difluoroanilino)-2-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CC(C)(C)/C=C/c1ccc(C(Cc2ccc(C(=O)NCCS(=O)(=O)O)cc2)C(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C30H32F2N2O5S/c1-30(2,3)15-14-20-4-8-22(9-5-20)25(29(36)34-24-12-13-26(31)27(32)19-24)18-21-6-10-23(11-7-21)28(35)33-16-17-40(37,38)39/h4-15,19,25H,16-18H2,1-3H3,(H,33,35)(H,34,36)(H,37,38,39)/b15-14+ |
| InChIKey | SYWRKLFVEUXWMW-CCEZHUSRSA-N |
| XLogP | 5.61 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|