C30H33ClN2O5S — CID 88866938
2-[[4-[3-(2-chloroanilino)-2-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88866938) has the molecular formula C30H33ClN2O5S and a molecular weight of 569.12 g/mol. Its IUPAC name is 2-[[4-[3-(2-chloroanilino)-2-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[3-(2-chloroanilino)-2-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88866938 |
| Molecular Formula | C30H33ClN2O5S |
| Molecular Weight | 569.12 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | 2-[[4-[3-(2-chloroanilino)-2-[4-[(E)-3,3-dimethylbut-1-enyl]phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CC(C)(C)/C=C/c1ccc(C(Cc2ccc(C(=O)NCCS(=O)(=O)O)cc2)C(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C30H33ClN2O5S/c1-30(2,3)17-16-21-8-12-23(13-9-21)25(29(35)33-27-7-5-4-6-26(27)31)20-22-10-14-24(15-11-22)28(34)32-18-19-39(36,37)38/h4-17,25H,18-20H2,1-3H3,(H,32,34)(H,33,35)(H,36,37,38)/b17-16+ |
| InChIKey | GORKUMNHAXEAFB-WUKNDPDISA-N |
| XLogP | 5.98 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.12 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|