C38H40N2O6S — CID 123146310
2-[[4-[3-[5-(1-benzofuran-2-yl)hexa-1,3,5-trien-2-ylamino]-2-[4-(3,3-dimethylbut-1-enyl)phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 123146310) has the molecular formula C38H40N2O6S and a molecular weight of 652.81 g/mol. Its IUPAC name is 2-[[4-[3-[5-(1-benzofuran-2-yl)hexa-1,3,5-trien-2-ylamino]-2-[4-(3,3-dimethylbut-1-enyl)phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[3-[5-(1-benzofuran-2-yl)hexa-1,3,5-trien-2-ylamino]-2-[4-(3,3-dimethylbut-1-enyl)phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 123146310 |
| Molecular Formula | C38H40N2O6S |
| Molecular Weight | 652.81 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | 2-[[4-[3-[5-(1-benzofuran-2-yl)hexa-1,3,5-trien-2-ylamino]-2-[4-(3,3-dimethylbut-1-enyl)phenyl]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | C=C(C=CC(=C)c1cc2ccccc2o1)NC(=O)C(Cc1ccc(C(=O)NCCS(=O)(=O)O)cc1)c1ccc(C=CC(C)(C)C)cc1 |
| InChI | InChI=1S/C38H40N2O6S/c1-26(35-25-32-8-6-7-9-34(32)46-35)10-11-27(2)40-37(42)33(30-16-12-28(13-17-30)20-21-38(3,4)5)24-29-14-18-31(19-15-29)36(41)39-22-23-47(43,44)45/h6-21,25,33H,1-2,22-24H2,3-5H3,(H,39,41)(H,40,42)(H,43,44,45) |
| InChIKey | QNLIXPXIGFMMJL-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.81 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|