C40H34FNO6S — CID 147504552
4-[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-[[4-(4-fluorophenyl)phenyl]methyl]-3-oxopropyl]phenyl]-4-oxobutane-1-sulfonic acid (PubChem CID 147504552) has the molecular formula C40H34FNO6S and a molecular weight of 675.78 g/mol. Its IUPAC name is 4-[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-[[4-(4-fluorophenyl)phenyl]methyl]-3-oxopropyl]phenyl]-4-oxobutane-1-sulfonic acid.
| Compound Name | 4-[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-[[4-(4-fluorophenyl)phenyl]methyl]-3-oxopropyl]phenyl]-4-oxobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 147504552 |
| Molecular Formula | C40H34FNO6S |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.21 |
| IUPAC Name | 4-[4-[3-[4-(1-benzofuran-2-yl)anilino]-2-[[4-(4-fluorophenyl)phenyl]methyl]-3-oxopropyl]phenyl]-4-oxobutane-1-sulfonic acid |
| SMILES | O=C(CCCS(=O)(=O)O)c1ccc(CC(Cc2ccc(-c3ccc(F)cc3)cc2)C(=O)Nc2ccc(-c3cc4ccccc4o3)cc2)cc1 |
| InChI | InChI=1S/C40H34FNO6S/c41-35-19-15-30(16-20-35)29-11-7-27(8-12-29)24-34(25-28-9-13-31(14-10-28)37(43)5-3-23-49(45,46)47)40(44)42-36-21-17-32(18-22-36)39-26-33-4-1-2-6-38(33)48-39/h1-2,4,6-22,26,34H,3,5,23-25H2,(H,42,44)(H,45,46,47) |
| InChIKey | FIBQHFQXPAVFDA-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|