C30H29Cl2NO5S — CID 146860133
4-[4-[2-[[4-(2,4-dichlorophenyl)phenyl]carbamoyl]hept-4-ynyl]phenyl]-4-oxobutane-1-sulfonic acid (PubChem CID 146860133) has the molecular formula C30H29Cl2NO5S and a molecular weight of 586.54 g/mol. Its IUPAC name is 4-[4-[2-[[4-(2,4-dichlorophenyl)phenyl]carbamoyl]hept-4-ynyl]phenyl]-4-oxobutane-1-sulfonic acid.
| Compound Name | 4-[4-[2-[[4-(2,4-dichlorophenyl)phenyl]carbamoyl]hept-4-ynyl]phenyl]-4-oxobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 146860133 |
| Molecular Formula | C30H29Cl2NO5S |
| Molecular Weight | 586.54 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | 4-[4-[2-[[4-(2,4-dichlorophenyl)phenyl]carbamoyl]hept-4-ynyl]phenyl]-4-oxobutane-1-sulfonic acid |
| SMILES | CCC#CCC(Cc1ccc(C(=O)CCCS(=O)(=O)O)cc1)C(=O)Nc1ccc(-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C30H29Cl2NO5S/c1-2-3-4-6-24(19-21-8-10-23(11-9-21)29(34)7-5-18-39(36,37)38)30(35)33-26-15-12-22(13-16-26)27-17-14-25(31)20-28(27)32/h8-17,20,24H,2,5-7,18-19H2,1H3,(H,33,35)(H,36,37,38) |
| InChIKey | SKKAKRRFCQBBNC-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.54 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|