C19H17NO5 — CID 22093535
(3S)-4-[[4-(1-benzofuran-2-yl)benzoyl]amino]-3-hydroxybutanoic acid (PubChem CID 22093535) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is (3S)-4-[[4-(1-benzofuran-2-yl)benzoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | (3S)-4-[[4-(1-benzofuran-2-yl)benzoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 22093535 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (3S)-4-[[4-(1-benzofuran-2-yl)benzoyl]amino]-3-hydroxybutanoic acid |
| SMILES | O=C(O)C[C@H](O)CNC(=O)c1ccc(-c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C19H17NO5/c21-15(10-18(22)23)11-20-19(24)13-7-5-12(6-8-13)17-9-14-3-1-2-4-16(14)25-17/h1-9,15,21H,10-11H2,(H,20,24)(H,22,23)/t15-/m0/s1 |
| InChIKey | ZNQOCXPXHBNLLT-HNNXBMFYSA-N |
| XLogP | 2.67 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |