C27H26N2O6 — CID 18468240
4-(1-benzofuran-2-yl)-N-[4-(hydroxyamino)-4-oxo-3-(phenylmethoxymethoxy)butyl]benzamide (PubChem CID 18468240) has the molecular formula C27H26N2O6 and a molecular weight of 474.51 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-N-[4-(hydroxyamino)-4-oxo-3-(phenylmethoxymethoxy)butyl]benzamide.
| Compound Name | 4-(1-benzofuran-2-yl)-N-[4-(hydroxyamino)-4-oxo-3-(phenylmethoxymethoxy)butyl]benzamide |
|---|---|
| PubChem CID | 18468240 |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-N-[4-(hydroxyamino)-4-oxo-3-(phenylmethoxymethoxy)butyl]benzamide |
| SMILES | O=C(NCCC(OCOCc1ccccc1)C(=O)NO)c1ccc(-c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C27H26N2O6/c30-26(21-12-10-20(11-13-21)25-16-22-8-4-5-9-23(22)35-25)28-15-14-24(27(31)29-32)34-18-33-17-19-6-2-1-3-7-19/h1-13,16,24,32H,14-15,17-18H2,(H,28,30)(H,29,31) |
| InChIKey | GHSYTTUDMYEMCB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|