C21H22N2O4 — CID 162656989
3-(1-benzofuran-2-yl)-N-[(2R,3R)-1-(hydroxyamino)-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 162656989) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-N-[(2R,3R)-1-(hydroxyamino)-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 3-(1-benzofuran-2-yl)-N-[(2R,3R)-1-(hydroxyamino)-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 162656989 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-N-[(2R,3R)-1-(hydroxyamino)-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)c1cccc(-c2cc3ccccc3o2)c1)C(=O)NO |
| InChI | InChI=1S/C21H22N2O4/c1-3-13(2)19(21(25)23-26)22-20(24)16-9-6-8-14(11-16)18-12-15-7-4-5-10-17(15)27-18/h4-13,19,26H,3H2,1-2H3,(H,22,24)(H,23,25)/t13-,19-/m1/s1 |
| InChIKey | DARYRCRYUYLUMU-BFUOFWGJSA-N |
| XLogP | 3.75 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|