C22H21NO5 — CID 4838410
3-methyl-2-[[3-(2-oxochromen-3-yl)benzoyl]amino]pentanoic acid (PubChem CID 4838410) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is 3-methyl-2-[[3-(2-oxochromen-3-yl)benzoyl]amino]pentanoic acid.
| Compound Name | 3-methyl-2-[[3-(2-oxochromen-3-yl)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 4838410 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 3-methyl-2-[[3-(2-oxochromen-3-yl)benzoyl]amino]pentanoic acid |
| SMILES | CCC(C)C(NC(=O)c1cccc(-c2cc3ccccc3oc2=O)c1)C(=O)O |
| InChI | InChI=1S/C22H21NO5/c1-3-13(2)19(21(25)26)23-20(24)16-9-6-8-14(11-16)17-12-15-7-4-5-10-18(15)28-22(17)27/h4-13,19H,3H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | JJIYXVXBBVJWCK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|