C17H19NO4 — CID 120517399
(2S,3S)-2-[[3-(furan-3-yl)benzoyl]amino]-3-methylpentanoic acid (PubChem CID 120517399) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is (2S,3S)-2-[[3-(furan-3-yl)benzoyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[[3-(furan-3-yl)benzoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 120517399 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (2S,3S)-2-[[3-(furan-3-yl)benzoyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1cccc(-c2ccoc2)c1)C(=O)O |
| InChI | InChI=1S/C17H19NO4/c1-3-11(2)15(17(20)21)18-16(19)13-6-4-5-12(9-13)14-7-8-22-10-14/h4-11,15H,3H2,1-2H3,(H,18,19)(H,20,21)/t11-,15-/m0/s1 |
| InChIKey | RKAOKGSYQOXHCB-NHYWBVRUSA-N |
| XLogP | 3.18 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |