C19H23NO5 — CID 120533658
2-[[3-(furan-3-yl)benzoyl]amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid (PubChem CID 120533658) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[[3-(furan-3-yl)benzoyl]amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid.
| Compound Name | 2-[[3-(furan-3-yl)benzoyl]amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 120533658 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-[[3-(furan-3-yl)benzoyl]amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
| SMILES | CC(C)(C)OCCC(NC(=O)c1cccc(-c2ccoc2)c1)C(=O)O |
| InChI | InChI=1S/C19H23NO5/c1-19(2,3)25-10-8-16(18(22)23)20-17(21)14-6-4-5-13(11-14)15-7-9-24-12-15/h4-7,9,11-12,16H,8,10H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | OAPREANTSWOFHG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |