C21H26N2O4 — CID 120533670
2-[(2-methyl-6-phenylpyridine-3-carbonyl)amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid (PubChem CID 120533670) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[(2-methyl-6-phenylpyridine-3-carbonyl)amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid.
| Compound Name | 2-[(2-methyl-6-phenylpyridine-3-carbonyl)amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 120533670 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-[(2-methyl-6-phenylpyridine-3-carbonyl)amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
| SMILES | Cc1nc(-c2ccccc2)ccc1C(=O)NC(CCOC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C21H26N2O4/c1-14-16(10-11-17(22-14)15-8-6-5-7-9-15)19(24)23-18(20(25)26)12-13-27-21(2,3)4/h5-11,18H,12-13H2,1-4H3,(H,23,24)(H,25,26) |
| InChIKey | LEXUBYHEBYEJIC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |