C15H19ClFNO4 — CID 120533737
2-[(4-chloro-3-fluorobenzoyl)amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid (PubChem CID 120533737) has the molecular formula C15H19ClFNO4 and a molecular weight of 331.77 g/mol. Its IUPAC name is 2-[(4-chloro-3-fluorobenzoyl)amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid.
| Compound Name | 2-[(4-chloro-3-fluorobenzoyl)amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 120533737 |
| Molecular Formula | C15H19ClFNO4 |
| Molecular Weight | 331.77 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-[(4-chloro-3-fluorobenzoyl)amino]-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
| SMILES | CC(C)(C)OCCC(NC(=O)c1ccc(Cl)c(F)c1)C(=O)O |
| InChI | InChI=1S/C15H19ClFNO4/c1-15(2,3)22-7-6-12(14(20)21)18-13(19)9-4-5-10(16)11(17)8-9/h4-5,8,12H,6-7H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | RSESSSSCNZZJHM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |