C14H17FN2O5 — CID 120702531
2-[(3-acetamido-4-fluorobenzoyl)amino]-4-methoxybutanoic acid (PubChem CID 120702531) has the molecular formula C14H17FN2O5 and a molecular weight of 312.30 g/mol. Its IUPAC name is 2-[(3-acetamido-4-fluorobenzoyl)amino]-4-methoxybutanoic acid.
| Compound Name | 2-[(3-acetamido-4-fluorobenzoyl)amino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 120702531 |
| Molecular Formula | C14H17FN2O5 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-[(3-acetamido-4-fluorobenzoyl)amino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)c1ccc(F)c(NC(C)=O)c1)C(=O)O |
| InChI | InChI=1S/C14H17FN2O5/c1-8(18)16-12-7-9(3-4-10(12)15)13(19)17-11(14(20)21)5-6-22-2/h3-4,7,11H,5-6H2,1-2H3,(H,16,18)(H,17,19)(H,20,21) |
| InChIKey | VLCYPGZHWDZDFG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |