C14H18BrClFNO — CID 114025307
N-(2-bromo-4,4-dimethylpentyl)-4-chloro-3-fluorobenzamide (PubChem CID 114025307) has the molecular formula C14H18BrClFNO and a molecular weight of 350.66 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)-4-chloro-3-fluorobenzamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)-4-chloro-3-fluorobenzamide |
|---|---|
| PubChem CID | 114025307 |
| Molecular Formula | C14H18BrClFNO |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)-4-chloro-3-fluorobenzamide |
| SMILES | CC(C)(C)CC(Br)CNC(=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H18BrClFNO/c1-14(2,3)7-10(15)8-18-13(19)9-4-5-11(16)12(17)6-9/h4-6,10H,7-8H2,1-3H3,(H,18,19) |
| InChIKey | LLAAIWZTNQWNBA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|