C15H21BrFNO — CID 107156586
N-(2-bromo-4,4-dimethylpentyl)-3-fluoro-5-methylbenzamide (PubChem CID 107156586) has the molecular formula C15H21BrFNO and a molecular weight of 330.24 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)-3-fluoro-5-methylbenzamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)-3-fluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 107156586 |
| Molecular Formula | C15H21BrFNO |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)-3-fluoro-5-methylbenzamide |
| SMILES | Cc1cc(F)cc(C(=O)NCC(Br)CC(C)(C)C)c1 |
| InChI | InChI=1S/C15H21BrFNO/c1-10-5-11(7-13(17)6-10)14(19)18-9-12(16)8-15(2,3)4/h5-7,12H,8-9H2,1-4H3,(H,18,19) |
| InChIKey | GIKMCYGRILCYJS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|