C17H26BrNO — CID 107156584
N-(2-bromo-4,4-dimethylpentyl)-2-(3,4-dimethylphenyl)acetamide (PubChem CID 107156584) has the molecular formula C17H26BrNO and a molecular weight of 340.31 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)-2-(3,4-dimethylphenyl)acetamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)-2-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 107156584 |
| Molecular Formula | C17H26BrNO |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)-2-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)NCC(Br)CC(C)(C)C)cc1C |
| InChI | InChI=1S/C17H26BrNO/c1-12-6-7-14(8-13(12)2)9-16(20)19-11-15(18)10-17(3,4)5/h6-8,15H,9-11H2,1-5H3,(H,19,20) |
| InChIKey | JPDGIXNDUXOGKX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|