C14H18Br2FNO — CID 107156635
4-bromo-N-(2-bromo-4,4-dimethylpentyl)-2-fluorobenzamide (PubChem CID 107156635) has the molecular formula C14H18Br2FNO and a molecular weight of 395.11 g/mol. Its IUPAC name is 4-bromo-N-(2-bromo-4,4-dimethylpentyl)-2-fluorobenzamide.
| Compound Name | 4-bromo-N-(2-bromo-4,4-dimethylpentyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 107156635 |
| Molecular Formula | C14H18Br2FNO |
| Molecular Weight | 395.11 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | 4-bromo-N-(2-bromo-4,4-dimethylpentyl)-2-fluorobenzamide |
| SMILES | CC(C)(C)CC(Br)CNC(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C14H18Br2FNO/c1-14(2,3)7-10(16)8-18-13(19)11-5-4-9(15)6-12(11)17/h4-6,10H,7-8H2,1-3H3,(H,18,19) |
| InChIKey | ZOJQJKHGSRIURK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.11 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|