C12H16BrFN2O — CID 120650065
4-bromo-N-[(2R)-2-(ethylamino)propyl]-2-fluorobenzamide (PubChem CID 120650065) has the molecular formula C12H16BrFN2O and a molecular weight of 303.18 g/mol. Its IUPAC name is 4-bromo-N-[(2R)-2-(ethylamino)propyl]-2-fluorobenzamide.
| Compound Name | 4-bromo-N-[(2R)-2-(ethylamino)propyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 120650065 |
| Molecular Formula | C12H16BrFN2O |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 4-bromo-N-[(2R)-2-(ethylamino)propyl]-2-fluorobenzamide |
| SMILES | CCN[C@H](C)CNC(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C12H16BrFN2O/c1-3-15-8(2)7-16-12(17)10-5-4-9(13)6-11(10)14/h4-6,8,15H,3,7H2,1-2H3,(H,16,17)/t8-/m1/s1 |
| InChIKey | SLEFZHJRRRZJNF-MRVPVSSYSA-N |
| XLogP | 2.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |