C16H24BrNO2 — CID 107156509
N-(2-bromo-4,4-dimethylpentyl)-4-ethoxybenzamide (PubChem CID 107156509) has the molecular formula C16H24BrNO2 and a molecular weight of 342.28 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)-4-ethoxybenzamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)-4-ethoxybenzamide |
|---|---|
| PubChem CID | 107156509 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(Br)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24BrNO2/c1-5-20-14-8-6-12(7-9-14)15(19)18-11-13(17)10-16(2,3)4/h6-9,13H,5,10-11H2,1-4H3,(H,18,19) |
| InChIKey | ZHJXBDVPTCHOBA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|