C16H24N2O3 — CID 108540579
N-[2-(2,2-dimethylpropanoylamino)ethyl]-4-ethoxybenzamide (PubChem CID 108540579) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[2-(2,2-dimethylpropanoylamino)ethyl]-4-ethoxybenzamide.
| Compound Name | N-[2-(2,2-dimethylpropanoylamino)ethyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 108540579 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-[2-(2,2-dimethylpropanoylamino)ethyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCCNC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24N2O3/c1-5-21-13-8-6-12(7-9-13)14(19)17-10-11-18-15(20)16(2,3)4/h6-9H,5,10-11H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | ULZPHGSNNQABMY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|