C25H35N3O4 — CID 17296274
4-ethoxy-N-[3-[3-[(4-ethoxybenzoyl)amino]propyl-methylamino]propyl]benzamide (PubChem CID 17296274) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is 4-ethoxy-N-[3-[3-[(4-ethoxybenzoyl)amino]propyl-methylamino]propyl]benzamide.
| Compound Name | 4-ethoxy-N-[3-[3-[(4-ethoxybenzoyl)amino]propyl-methylamino]propyl]benzamide |
|---|---|
| PubChem CID | 17296274 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 4-ethoxy-N-[3-[3-[(4-ethoxybenzoyl)amino]propyl-methylamino]propyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCCCN(C)CCCNC(=O)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C25H35N3O4/c1-4-31-22-12-8-20(9-13-22)24(29)26-16-6-18-28(3)19-7-17-27-25(30)21-10-14-23(15-11-21)32-5-2/h8-15H,4-7,16-19H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | HGPXIKGIDHCITN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|