C14H19ClFNO — CID 107156883
N-(2-chloro-4,4-dimethylpentyl)-3-fluorobenzamide (PubChem CID 107156883) has the molecular formula C14H19ClFNO and a molecular weight of 271.76 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)-3-fluorobenzamide.
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 107156883 |
| Molecular Formula | C14H19ClFNO |
| Molecular Weight | 271.76 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)-3-fluorobenzamide |
| SMILES | CC(C)(C)CC(Cl)CNC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C14H19ClFNO/c1-14(2,3)8-11(15)9-17-13(18)10-5-4-6-12(16)7-10/h4-7,11H,8-9H2,1-3H3,(H,17,18) |
| InChIKey | UXEYOYLDUZJEQY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|