C14H19ClN2O3 — CID 107156902
N-(2-chloro-4,4-dimethylpentyl)-3-nitrobenzamide (PubChem CID 107156902) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)-3-nitrobenzamide.
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 107156902 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)-3-nitrobenzamide |
| SMILES | CC(C)(C)CC(Cl)CNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H19ClN2O3/c1-14(2,3)8-11(15)9-16-13(18)10-5-4-6-12(7-10)17(19)20/h4-7,11H,8-9H2,1-3H3,(H,16,18) |
| InChIKey | ZZIIFOZEJCIXFB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|