C13H16FNO2 — CID 64991573
N-(3,3-dimethyl-2-oxobutyl)-3-fluorobenzamide (PubChem CID 64991573) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is N-(3,3-dimethyl-2-oxobutyl)-3-fluorobenzamide.
| Compound Name | N-(3,3-dimethyl-2-oxobutyl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 64991573 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-(3,3-dimethyl-2-oxobutyl)-3-fluorobenzamide |
| SMILES | CC(C)(C)C(=O)CNC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C13H16FNO2/c1-13(2,3)11(16)8-15-12(17)9-5-4-6-10(14)7-9/h4-7H,8H2,1-3H3,(H,15,17) |
| InChIKey | KBTMLXDMOYNJNF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |