C14H19FN2O3 — CID 79380984
3-fluoro-N-[2-[(2-hydroxy-2-methylpropyl)-methylamino]-2-oxoethyl]benzamide (PubChem CID 79380984) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is 3-fluoro-N-[2-[(2-hydroxy-2-methylpropyl)-methylamino]-2-oxoethyl]benzamide.
| Compound Name | 3-fluoro-N-[2-[(2-hydroxy-2-methylpropyl)-methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 79380984 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-fluoro-N-[2-[(2-hydroxy-2-methylpropyl)-methylamino]-2-oxoethyl]benzamide |
| SMILES | CN(CC(C)(C)O)C(=O)CNC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C14H19FN2O3/c1-14(2,20)9-17(3)12(18)8-16-13(19)10-5-4-6-11(15)7-10/h4-7,20H,8-9H2,1-3H3,(H,16,19) |
| InChIKey | LVLYBAMWBYDPOM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |