C10H8ClF4NO2 — CID 103876622
4-chloro-3-fluoro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide (PubChem CID 103876622) has the molecular formula C10H8ClF4NO2 and a molecular weight of 285.62 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide.
| Compound Name | 4-chloro-3-fluoro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide |
|---|---|
| PubChem CID | 103876622 |
| Molecular Formula | C10H8ClF4NO2 |
| Molecular Weight | 285.62 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 4-chloro-3-fluoro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide |
| SMILES | O=C(NCC(O)C(F)(F)F)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C10H8ClF4NO2/c11-6-2-1-5(3-7(6)12)9(18)16-4-8(17)10(13,14)15/h1-3,8,17H,4H2,(H,16,18) |
| InChIKey | SMJYJJHABUEYKK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.62 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |