C14H19ClFNO2 — CID 107989597
4-chloro-3-fluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzamide (PubChem CID 107989597) has the molecular formula C14H19ClFNO2 and a molecular weight of 287.76 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzamide.
| Compound Name | 4-chloro-3-fluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzamide |
|---|---|
| PubChem CID | 107989597 |
| Molecular Formula | C14H19ClFNO2 |
| Molecular Weight | 287.76 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 4-chloro-3-fluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzamide |
| SMILES | CC(C)CC(C)(O)CNC(=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H19ClFNO2/c1-9(2)7-14(3,19)8-17-13(18)10-4-5-11(15)12(16)6-10/h4-6,9,19H,7-8H2,1-3H3,(H,17,18) |
| InChIKey | MTKZLUKPZHENKH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.76 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |