C14H18BrClFNO — CID 106145651
N-(5-bromo-2,2-dimethylpentyl)-4-chloro-3-fluorobenzamide (PubChem CID 106145651) has the molecular formula C14H18BrClFNO and a molecular weight of 350.66 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)-4-chloro-3-fluorobenzamide.
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)-4-chloro-3-fluorobenzamide |
|---|---|
| PubChem CID | 106145651 |
| Molecular Formula | C14H18BrClFNO |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)-4-chloro-3-fluorobenzamide |
| SMILES | CC(C)(CCCBr)CNC(=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H18BrClFNO/c1-14(2,6-3-7-15)9-18-13(19)10-4-5-11(16)12(17)8-10/h4-5,8H,3,6-7,9H2,1-2H3,(H,18,19) |
| InChIKey | WAZDEFXWSRXNOK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|