C15H20BrF2NO — CID 106145115
N-(5-bromo-2,2-dimethylpentyl)-2,4-difluoro-5-methylbenzamide (PubChem CID 106145115) has the molecular formula C15H20BrF2NO and a molecular weight of 348.23 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)-2,4-difluoro-5-methylbenzamide.
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)-2,4-difluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 106145115 |
| Molecular Formula | C15H20BrF2NO |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)-2,4-difluoro-5-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCC(C)(C)CCCBr)c(F)cc1F |
| InChI | InChI=1S/C15H20BrF2NO/c1-10-7-11(13(18)8-12(10)17)14(20)19-9-15(2,3)5-4-6-16/h7-8H,4-6,9H2,1-3H3,(H,19,20) |
| InChIKey | CTRPQKFKBPATEZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|