C13H17BrFNO — CID 115364948
N-(3-bromo-2,2-dimethylpropyl)-2-fluoro-5-methylbenzamide (PubChem CID 115364948) has the molecular formula C13H17BrFNO and a molecular weight of 302.19 g/mol. Its IUPAC name is N-(3-bromo-2,2-dimethylpropyl)-2-fluoro-5-methylbenzamide.
| Compound Name | N-(3-bromo-2,2-dimethylpropyl)-2-fluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 115364948 |
| Molecular Formula | C13H17BrFNO |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-(3-bromo-2,2-dimethylpropyl)-2-fluoro-5-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)NCC(C)(C)CBr)c1 |
| InChI | InChI=1S/C13H17BrFNO/c1-9-4-5-11(15)10(6-9)12(17)16-8-13(2,3)7-14/h4-6H,7-8H2,1-3H3,(H,16,17) |
| InChIKey | SKQRGKGOKFFNNP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|