C10H11FN2O2 — CID 62511254
N-(2-amino-2-oxoethyl)-2-fluoro-5-methylbenzamide (PubChem CID 62511254) has the molecular formula C10H11FN2O2 and a molecular weight of 210.21 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2-fluoro-5-methylbenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2-fluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 62511254 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2-fluoro-5-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)NCC(N)=O)c1 |
| InChI | InChI=1S/C10H11FN2O2/c1-6-2-3-8(11)7(4-6)10(15)13-5-9(12)14/h2-4H,5H2,1H3,(H2,12,14)(H,13,15) |
| InChIKey | QGMPKVLYMIAUCD-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |