C10H9F4NO — CID 62510396
2-fluoro-5-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 62510396) has the molecular formula C10H9F4NO and a molecular weight of 235.18 g/mol. Its IUPAC name is 2-fluoro-5-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-fluoro-5-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 62510396 |
| Molecular Formula | C10H9F4NO |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-fluoro-5-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1ccc(F)c(C(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F4NO/c1-6-2-3-8(11)7(4-6)9(16)15-5-10(12,13)14/h2-4H,5H2,1H3,(H,15,16) |
| InChIKey | OHHQJUOWEYIEMT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |