C13H22BrN3O — CID 106145643
N-(5-bromo-2,2-dimethylpentyl)-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 106145643) has the molecular formula C13H22BrN3O and a molecular weight of 316.24 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 106145643 |
| Molecular Formula | C13H22BrN3O |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)NCC(C)(C)CCCBr |
| InChI | InChI=1S/C13H22BrN3O/c1-10-11(8-17(4)16-10)12(18)15-9-13(2,3)6-5-7-14/h8H,5-7,9H2,1-4H3,(H,15,18) |
| InChIKey | XNXBUJJBXXTFAA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|